C17H14Cl6N4O3 — CID 89010035
2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N-(3-hydroxy-2-oxobutyl)anilino]acetaldehyde (PubChem CID 89010035) has the molecular formula C17H14Cl6N4O3 and a molecular weight of 535.04 g/mol. Its IUPAC name is 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N-(3-hydroxy-2-oxobutyl)anilino]acetaldehyde.
| Compound Name | 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N-(3-hydroxy-2-oxobutyl)anilino]acetaldehyde |
|---|---|
| PubChem CID | 89010035 |
| Molecular Formula | C17H14Cl6N4O3 |
| Molecular Weight | 535.04 g/mol |
| Exact Mass | 531.92 |
| IUPAC Name | 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N-(3-hydroxy-2-oxobutyl)anilino]acetaldehyde |
| SMILES | CC(O)C(=O)CN(CC=O)c1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C17H14Cl6N4O3/c1-9(29)12(30)8-27(6-7-28)11-4-2-10(3-5-11)13-24-14(16(18,19)20)26-15(25-13)17(21,22)23/h2-5,7,9,29H,6,8H2,1H3 |
| InChIKey | MJEJAVWSKXASAS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.04 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|