C25H30F4N4O2 — CID 89010147
(2E)-2-[amino-(4-fluoro-N-methylanilino)methylidene]-N-[2-[[benzyl(ethyl)amino]methyl]-3,3,3-trifluoro-2-hydroxypropyl]but-3-enamide (PubChem CID 89010147) has the molecular formula C25H30F4N4O2 and a molecular weight of 494.53 g/mol. Its IUPAC name is (2E)-2-[amino-(4-fluoro-N-methylanilino)methylidene]-N-[2-[[benzyl(ethyl)amino]methyl]-3,3,3-trifluoro-2-hydroxypropyl]but-3-enamide.
| Compound Name | (2E)-2-[amino-(4-fluoro-N-methylanilino)methylidene]-N-[2-[[benzyl(ethyl)amino]methyl]-3,3,3-trifluoro-2-hydroxypropyl]but-3-enamide |
|---|---|
| PubChem CID | 89010147 |
| Molecular Formula | C25H30F4N4O2 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | (2E)-2-[amino-(4-fluoro-N-methylanilino)methylidene]-N-[2-[[benzyl(ethyl)amino]methyl]-3,3,3-trifluoro-2-hydroxypropyl]but-3-enamide |
| SMILES | C=C/C(C(=O)NCC(O)(CN(CC)Cc1ccccc1)C(F)(F)F)=C(/N)N(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H30F4N4O2/c1-4-21(22(30)32(3)20-13-11-19(26)12-14-20)23(34)31-16-24(35,25(27,28)29)17-33(5-2)15-18-9-7-6-8-10-18/h4,6-14,35H,1,5,15-17,30H2,2-3H3,(H,31,34)/b22-21+ |
| InChIKey | PNHMEQOWNQIIEQ-QURGRASLSA-N |
| XLogP | 3.55 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|