C12H16F3N — CID 89010256
(Z)-1,1,1-trifluoro-N,3-bis(prop-1-en-2-yl)hex-3-en-2-imine (PubChem CID 89010256) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-N,3-bis(prop-1-en-2-yl)hex-3-en-2-imine.
| Compound Name | (Z)-1,1,1-trifluoro-N,3-bis(prop-1-en-2-yl)hex-3-en-2-imine |
|---|---|
| PubChem CID | 89010256 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (Z)-1,1,1-trifluoro-N,3-bis(prop-1-en-2-yl)hex-3-en-2-imine |
| SMILES | C=C(C)/N=C(C(=C\CC)/C(=C)C)\C(F)(F)F |
| InChI | InChI=1S/C12H16F3N/c1-6-7-10(8(2)3)11(12(13,14)15)16-9(4)5/h7H,2,4,6H2,1,3,5H3/b10-7-,16-11- |
| InChIKey | ZUNLCXLWTLVLAR-PGWBGFSZSA-N |
| XLogP | 4.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|