About N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine
N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine (PubChem CID 89010387) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine |
| PubChem CID | 89010387 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine |
| SMILES | CNC[C@H]1C[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C12H17N/c1-9-3-5-10(6-4-9)12-7-11(12)8-13-2/h3-6,11-13H,7-8H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | VGQGBZHDCGMTKZ-VXGBXAGGSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine?
The IUPAC name of N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine (CID 89010387) is N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine.
What is the SMILES notation for N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine?
The canonical SMILES for N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine is CNC[C@H]1C[C@@H]1c1ccc(C)cc1.
What is the InChIKey of N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine?
The InChIKey is VGQGBZHDCGMTKZ-VXGBXAGGSA-N. The full InChI is InChI=1S/C12H17N/c1-9-3-5-10(6-4-9)12-7-11(12)8-13-2/h3-6,11-13H,7-8H2,1-2H3/t11-,12-/m1/s1.
What are the key properties of N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine?
N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine has a molecular weight of 175.27 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[(1S,2S)-2-(4-methylphenyl)cyclopropyl]methanamine is sourced from PubChem (CID 89010387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).