C12H21N — CID 89010406
(1S,7S)-1,4,6-trimethyl-3-azatricyclo[5.2.1.02,6]decane (PubChem CID 89010406) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (1S,7S)-1,4,6-trimethyl-3-azatricyclo[5.2.1.02,6]decane.
| Compound Name | (1S,7S)-1,4,6-trimethyl-3-azatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 89010406 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (1S,7S)-1,4,6-trimethyl-3-azatricyclo[5.2.1.02,6]decane |
| SMILES | CC1CC2(C)C(N1)[C@@]1(C)CC[C@H]2C1 |
| InChI | InChI=1S/C12H21N/c1-8-6-12(3)9-4-5-11(2,7-9)10(12)13-8/h8-10,13H,4-7H2,1-3H3/t8?,9-,10?,11-,12?/m0/s1 |
| InChIKey | DYVNQEMCUGFBNX-KNHGFYQXSA-N |
| XLogP | 2.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |