C9H15NO — CID 89010550
(2E,4E)-4-amino-7-methylocta-2,4,7-trien-3-ol (PubChem CID 89010550) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (2E,4E)-4-amino-7-methylocta-2,4,7-trien-3-ol.
| Compound Name | (2E,4E)-4-amino-7-methylocta-2,4,7-trien-3-ol |
|---|---|
| PubChem CID | 89010550 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (2E,4E)-4-amino-7-methylocta-2,4,7-trien-3-ol |
| SMILES | C=C(C)C/C=C(N)\C(O)=C/C |
| InChI | InChI=1S/C9H15NO/c1-4-9(11)8(10)6-5-7(2)3/h4,6,11H,2,5,10H2,1,3H3/b8-6+,9-4+ |
| InChIKey | XEZZFBYZDKWVEI-KRDKKKDJSA-N |
| XLogP | 2.26 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|