C9H6F8N2O2 — CID 89010634
(E)-3-amino-4,4,4-trifluoro-2-(3,3,4,4,4-pentafluorobut-1-en-2-yliminomethyl)but-2-enoic acid (PubChem CID 89010634) has the molecular formula C9H6F8N2O2 and a molecular weight of 326.14 g/mol. Its IUPAC name is (E)-3-amino-4,4,4-trifluoro-2-(3,3,4,4,4-pentafluorobut-1-en-2-yliminomethyl)but-2-enoic acid.
| Compound Name | (E)-3-amino-4,4,4-trifluoro-2-(3,3,4,4,4-pentafluorobut-1-en-2-yliminomethyl)but-2-enoic acid |
|---|---|
| PubChem CID | 89010634 |
| Molecular Formula | C9H6F8N2O2 |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | (E)-3-amino-4,4,4-trifluoro-2-(3,3,4,4,4-pentafluorobut-1-en-2-yliminomethyl)but-2-enoic acid |
| SMILES | C=C(/N=C/C(C(=O)O)=C(\N)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F8N2O2/c1-3(7(10,11)9(15,16)17)19-2-4(6(20)21)5(18)8(12,13)14/h2H,1,18H2,(H,20,21)/b5-4+,19-2+ |
| InChIKey | LCEQBTWPLLPTHJ-HPLYADSNSA-N |
| XLogP | 2.63 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|