C26H39BN2O3 — CID 89010793
3-methyl-1-[(2S)-2-[C-methyl-N-[(E)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-1-enyl]carbonimidoyl]pyrrolidin-1-yl]butan-1-one (PubChem CID 89010793) has the molecular formula C26H39BN2O3 and a molecular weight of 438.42 g/mol. Its IUPAC name is 3-methyl-1-[(2S)-2-[C-methyl-N-[(E)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-1-enyl]carbonimidoyl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | 3-methyl-1-[(2S)-2-[C-methyl-N-[(E)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-1-enyl]carbonimidoyl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 89010793 |
| Molecular Formula | C26H39BN2O3 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | 3-methyl-1-[(2S)-2-[C-methyl-N-[(E)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-1-enyl]carbonimidoyl]pyrrolidin-1-yl]butan-1-one |
| SMILES | C/C(=C\N=C(/C)[C@@H]1CCCN1C(=O)CC(C)C)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C26H39BN2O3/c1-18(2)16-24(30)29-15-9-10-23(29)20(4)28-17-19(3)21-11-13-22(14-12-21)27-31-25(5,6)26(7,8)32-27/h11-14,17-18,23H,9-10,15-16H2,1-8H3/b19-17+,28-20+/t23-/m0/s1 |
| InChIKey | DHAJQTJZLFPCGT-CQBURSIGSA-N |
| XLogP | 4.84 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|