C24H29BN4O5 — CID 89011011
CID 89011011 (PubChem CID 89011011) has the molecular formula C24H29BN4O5 and a molecular weight of 464.33 g/mol.
| Compound Name | CID 89011011 |
|---|---|
| PubChem CID | 89011011 |
| Molecular Formula | C24H29BN4O5 |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)CNC(=O)[C@H](CNc2ccccc2)NC(=O)[C@@H](NC(=O)OC)C(C)C)cc1 |
| InChI | InChI=1S/C24H29BN4O5/c1-15(2)21(29-24(33)34-3)23(32)28-19(13-26-18-7-5-4-6-8-18)22(31)27-14-20(30)16-9-11-17(25)12-10-16/h4-12,15,19,21,26H,13-14H2,1-3H3,(H,27,31)(H,28,32)(H,29,33)/t19-,21-/m0/s1 |
| InChIKey | RWHCKNMXDKWOPL-FPOVZHCZSA-N |
| XLogP | 0.76 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|