C15H22N2 — CID 89011076
(1Z,3E)-1-[(4Z)-2-methyl-4-[2-[(Z)-prop-1-enyl]iminoethylidene]cyclobutyl]penta-1,3-dien-3-amine (PubChem CID 89011076) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is (1Z,3E)-1-[(4Z)-2-methyl-4-[2-[(Z)-prop-1-enyl]iminoethylidene]cyclobutyl]penta-1,3-dien-3-amine.
| Compound Name | (1Z,3E)-1-[(4Z)-2-methyl-4-[2-[(Z)-prop-1-enyl]iminoethylidene]cyclobutyl]penta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 89011076 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (1Z,3E)-1-[(4Z)-2-methyl-4-[2-[(Z)-prop-1-enyl]iminoethylidene]cyclobutyl]penta-1,3-dien-3-amine |
| SMILES | C/C=C\N=C/C=C1/CC(C)C1/C=C\C(N)=C/C |
| InChI | InChI=1S/C15H22N2/c1-4-9-17-10-8-13-11-12(3)15(13)7-6-14(16)5-2/h4-10,12,15H,11,16H2,1-3H3/b7-6-,9-4-,13-8-,14-5+,17-10- |
| InChIKey | YEICPXPWSPXKHH-YOTFIPAVSA-N |
| XLogP | 3.59 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|