C17H17FN4O — CID 89011151
N'-[(1Z)-3-[6-(4-fluorophenyl)-7,7a-dihydroimidazo[2,1-b][1,3]oxazol-5-yl]buta-1,3-dienyl]ethanimidamide (PubChem CID 89011151) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is N'-[(1Z)-3-[6-(4-fluorophenyl)-7,7a-dihydroimidazo[2,1-b][1,3]oxazol-5-yl]buta-1,3-dienyl]ethanimidamide.
| Compound Name | N'-[(1Z)-3-[6-(4-fluorophenyl)-7,7a-dihydroimidazo[2,1-b][1,3]oxazol-5-yl]buta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 89011151 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N'-[(1Z)-3-[6-(4-fluorophenyl)-7,7a-dihydroimidazo[2,1-b][1,3]oxazol-5-yl]buta-1,3-dienyl]ethanimidamide |
| SMILES | C=C(/C=C\N=C(/C)N)C1=C(c2ccc(F)cc2)NC2OC=CN12 |
| InChI | InChI=1S/C17H17FN4O/c1-11(7-8-20-12(2)19)16-15(13-3-5-14(18)6-4-13)21-17-22(16)9-10-23-17/h3-10,17,21H,1H2,2H3,(H2,19,20)/b8-7- |
| InChIKey | UZJZBJVIGSTZTA-FPLPWBNLSA-N |
| XLogP | 2.63 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|