About 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile
5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile (PubChem CID 89011166) has the molecular formula C8H8N6
and a molecular weight of 188.19 g/mol. Its IUPAC name is 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile |
| PubChem CID | 89011166 |
| Molecular Formula | C8H8N6 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(C2=NCC=CN2)c1N |
| InChI | InChI=1S/C8H8N6/c9-4-6-5-13-14(7(6)10)8-11-2-1-3-12-8/h1-2,5H,3,10H2,(H,11,12) |
| InChIKey | JZYABGFMBPGKPS-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile?
The IUPAC name of 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile (CID 89011166) is 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile.
What is the SMILES notation for 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile?
The canonical SMILES for 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile is N#Cc1cnn(C2=NCC=CN2)c1N.
What is the InChIKey of 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile?
The InChIKey is JZYABGFMBPGKPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N6/c9-4-6-5-13-14(7(6)10)8-11-2-1-3-12-8/h1-2,5H,3,10H2,(H,11,12).
What are the key properties of 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile?
5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile has a molecular weight of 188.19 g/mol, XLogP of -0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(1,4-dihydropyrimidin-2-yl)pyrazole-4-carbonitrile is sourced from PubChem (CID 89011166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).