C18H17F2N3OS — CID 89011495
2-[5-(cyclopentylamino)-6-(2,6-difluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetaldehyde (PubChem CID 89011495) has the molecular formula C18H17F2N3OS and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-[5-(cyclopentylamino)-6-(2,6-difluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetaldehyde.
| Compound Name | 2-[5-(cyclopentylamino)-6-(2,6-difluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 89011495 |
| Molecular Formula | C18H17F2N3OS |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[5-(cyclopentylamino)-6-(2,6-difluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetaldehyde |
| SMILES | O=CCc1csc2nc(-c3c(F)cccc3F)c(NC3CCCC3)n12 |
| InChI | InChI=1S/C18H17F2N3OS/c19-13-6-3-7-14(20)15(13)16-17(21-11-4-1-2-5-11)23-12(8-9-24)10-25-18(23)22-16/h3,6-7,9-11,21H,1-2,4-5,8H2 |
| InChIKey | WVHWAMQOHCLHPX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|