About N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine
N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine (PubChem CID 89011586) has the molecular formula C7H11F3N2
and a molecular weight of 180.17 g/mol. Its IUPAC name is N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine.
Molecular Properties
| Compound Name | N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine |
| PubChem CID | 89011586 |
| Molecular Formula | C7H11F3N2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine |
| SMILES | C=C/C(=N\N(C)CC)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2/c1-4-6(7(8,9)10)11-12(3)5-2/h4H,1,5H2,2-3H3/b11-6+ |
| InChIKey | AMDYHXLQOKUGOL-IZZDOVSWSA-N |
| XLogP | 2.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine?
The IUPAC name of N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine (CID 89011586) is N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine.
What is the SMILES notation for N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine?
The canonical SMILES for N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine is C=C/C(=N\N(C)CC)C(F)(F)F.
What is the InChIKey of N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine?
The InChIKey is AMDYHXLQOKUGOL-IZZDOVSWSA-N. The full InChI is InChI=1S/C7H11F3N2/c1-4-6(7(8,9)10)11-12(3)5-2/h4H,1,5H2,2-3H3/b11-6+.
What are the key properties of N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine?
N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine has a molecular weight of 180.17 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(E)-1,1,1-trifluorobut-3-en-2-ylideneamino]ethanamine is sourced from PubChem (CID 89011586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).