C12H16N2 — CID 89011592
2,6-dimethyl-1,5,6,7,8,8a-hexahydropyrrolo[3,2-f]indole (PubChem CID 89011592) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2,6-dimethyl-1,5,6,7,8,8a-hexahydropyrrolo[3,2-f]indole.
| Compound Name | 2,6-dimethyl-1,5,6,7,8,8a-hexahydropyrrolo[3,2-f]indole |
|---|---|
| PubChem CID | 89011592 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2,6-dimethyl-1,5,6,7,8,8a-hexahydropyrrolo[3,2-f]indole |
| SMILES | CC1=CC2=CC3=C(CC2N1)NC(C)C3 |
| InChI | InChI=1S/C12H16N2/c1-7-3-9-5-10-4-8(2)14-12(10)6-11(9)13-7/h3,5,8,11,13-14H,4,6H2,1-2H3 |
| InChIKey | IQBURIBDNWYTEQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |