About 2-methoxybutoxyphosphane
2-methoxybutoxyphosphane (PubChem CID 89011772) has the molecular formula C5H13O2P
and a molecular weight of 136.13 g/mol. Its IUPAC name is 2-methoxybutoxyphosphane.
Molecular Properties
| Compound Name | 2-methoxybutoxyphosphane |
| PubChem CID | 89011772 |
| Molecular Formula | C5H13O2P |
| Molecular Weight | 136.13 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 2-methoxybutoxyphosphane |
| SMILES | CCC(COP)OC |
| InChI | InChI=1S/C5H13O2P/c1-3-5(6-2)4-7-8/h5H,3-4,8H2,1-2H3 |
| InChIKey | GDGFVNBBVHLSCW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.13 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxybutoxyphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybutoxyphosphane?
The IUPAC name of 2-methoxybutoxyphosphane (CID 89011772) is 2-methoxybutoxyphosphane.
What is the SMILES notation for 2-methoxybutoxyphosphane?
The canonical SMILES for 2-methoxybutoxyphosphane is CCC(COP)OC.
What is the InChIKey of 2-methoxybutoxyphosphane?
The InChIKey is GDGFVNBBVHLSCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13O2P/c1-3-5(6-2)4-7-8/h5H,3-4,8H2,1-2H3.
What are the key properties of 2-methoxybutoxyphosphane?
2-methoxybutoxyphosphane has a molecular weight of 136.13 g/mol, XLogP of 1.22, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybutoxyphosphane is sourced from PubChem (CID 89011772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).