About prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate
prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate (PubChem CID 89011794) has the molecular formula C20H24N4O2
and a molecular weight of 352.44 g/mol. Its IUPAC name is prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate |
| PubChem CID | 89011794 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate |
| SMILES | C=C(C)OC(=O)N1CCC(c2ncnc3cc(N4CCC4)ccc23)CC1 |
| InChI | InChI=1S/C20H24N4O2/c1-14(2)26-20(25)24-10-6-15(7-11-24)19-17-5-4-16(23-8-3-9-23)12-18(17)21-13-22-19/h4-5,12-13,15H,1,3,6-11H2,2H3 |
| InChIKey | HKTXDVSYISZWRY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate?
The IUPAC name of prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate (CID 89011794) is prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate.
What is the SMILES notation for prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate?
The canonical SMILES for prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate is C=C(C)OC(=O)N1CCC(c2ncnc3cc(N4CCC4)ccc23)CC1.
What is the InChIKey of prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate?
The InChIKey is HKTXDVSYISZWRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O2/c1-14(2)26-20(25)24-10-6-15(7-11-24)19-17-5-4-16(23-8-3-9-23)12-18(17)21-13-22-19/h4-5,12-13,15H,1,3,6-11H2,2H3.
What are the key properties of prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate?
prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate has a molecular weight of 352.44 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-yl 4-[7-(azetidin-1-yl)quinazolin-4-yl]piperidine-1-carboxylate is sourced from PubChem (CID 89011794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).