About (7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene
(7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene (PubChem CID 89011976) has the molecular formula C10H13FO
and a molecular weight of 168.21 g/mol. Its IUPAC name is (7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene.
Analyze (7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene?
The IUPAC name of (7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene (CID 89011976) is (7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene.
What is the SMILES notation for (7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene?
The canonical SMILES for (7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene is CC1=CC2=C(C[C@H]1F)OCCC2.
What is the InChIKey of (7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene?
The InChIKey is UDHDLAODLQDMRK-SECBINFHSA-N. The full InChI is InChI=1S/C10H13FO/c1-7-5-8-3-2-4-12-10(8)6-9(7)11/h5,9H,2-4,6H2,1H3/t9-/m1/s1.
What are the key properties of (7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene?
(7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene has a molecular weight of 168.21 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-7-fluoro-6-methyl-3,4,7,8-tetrahydro-2H-chromene is sourced from PubChem (CID 89011976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).