C15H16O4 — CID 89012038
(9bS)-8-(methoxymethoxy)-2-methylidene-1,3,3a,9b-tetrahydrocyclopenta[c]chromen-4-one (PubChem CID 89012038) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (9bS)-8-(methoxymethoxy)-2-methylidene-1,3,3a,9b-tetrahydrocyclopenta[c]chromen-4-one.
| Compound Name | (9bS)-8-(methoxymethoxy)-2-methylidene-1,3,3a,9b-tetrahydrocyclopenta[c]chromen-4-one |
|---|---|
| PubChem CID | 89012038 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (9bS)-8-(methoxymethoxy)-2-methylidene-1,3,3a,9b-tetrahydrocyclopenta[c]chromen-4-one |
| SMILES | C=C1CC2C(=O)Oc3ccc(OCOC)cc3[C@H]2C1 |
| InChI | InChI=1S/C15H16O4/c1-9-5-11-12-7-10(18-8-17-2)3-4-14(12)19-15(16)13(11)6-9/h3-4,7,11,13H,1,5-6,8H2,2H3/t11-,13?/m1/s1 |
| InChIKey | KUJMVZLSZYBMNK-JTDNENJMSA-N |
| XLogP | 2.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|