C28H41N3O8 — CID 89012129
[(4E,6Z,10E,12S,14S,16R)-19-amino-13,20,22-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate (PubChem CID 89012129) has the molecular formula C28H41N3O8 and a molecular weight of 547.65 g/mol. Its IUPAC name is [(4E,6Z,10E,12S,14S,16R)-19-amino-13,20,22-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,10E,12S,14S,16R)-19-amino-13,20,22-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
|---|---|
| PubChem CID | 89012129 |
| Molecular Formula | C28H41N3O8 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | [(4E,6Z,10E,12S,14S,16R)-19-amino-13,20,22-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18(22),19-hexaen-9-yl] carbamate |
| SMILES | COC1/C=C\C=C(/C)C(=O)Nc2cc(O)c(N)c(c2O)C[C@@H](C)C[C@H](OC)C(O)[C@@H](C)/C=C(\C)C1OC(N)=O |
| InChI | InChI=1S/C28H41N3O8/c1-14-10-18-23(29)20(32)13-19(25(18)34)31-27(35)15(2)8-7-9-21(37-5)26(39-28(30)36)17(4)12-16(3)24(33)22(11-14)38-6/h7-9,12-14,16,21-22,24,26,32-34H,10-11,29H2,1-6H3,(H2,30,36)(H,31,35)/b9-7-,15-8+,17-12+/t14-,16+,21?,22+,24?,26?/m1/s1 |
| InChIKey | OLZVLNRBIKBPIX-FBPNHSTMSA-N |
| XLogP | 3.14 |
| TPSA | 186.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|