C21H16F6N2O4 — CID 89012182
4-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(hydroxymethyl)-N,N-dimethylbenzamide (PubChem CID 89012182) has the molecular formula C21H16F6N2O4 and a molecular weight of 474.36 g/mol. Its IUPAC name is 4-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(hydroxymethyl)-N,N-dimethylbenzamide.
| Compound Name | 4-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(hydroxymethyl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 89012182 |
| Molecular Formula | C21H16F6N2O4 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 4-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(hydroxymethyl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(C(c2ccc3c(c2)C(=O)NC3=O)(C(F)(F)F)C(F)(F)F)cc1CO |
| InChI | InChI=1S/C21H16F6N2O4/c1-29(2)18(33)13-5-3-11(7-10(13)9-30)19(20(22,23)24,21(25,26)27)12-4-6-14-15(8-12)17(32)28-16(14)31/h3-8,30H,9H2,1-2H3,(H,28,31,32) |
| InChIKey | HNZTURUYSUULND-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|