C21H32S — CID 89012218
2-butan-2-yl-5-[(2E,4E)-6,6-dimethyl-5-prop-1-en-2-ylocta-2,4-dien-2-yl]thiophene (PubChem CID 89012218) has the molecular formula C21H32S and a molecular weight of 316.55 g/mol. Its IUPAC name is 2-butan-2-yl-5-[(2E,4E)-6,6-dimethyl-5-prop-1-en-2-ylocta-2,4-dien-2-yl]thiophene.
| Compound Name | 2-butan-2-yl-5-[(2E,4E)-6,6-dimethyl-5-prop-1-en-2-ylocta-2,4-dien-2-yl]thiophene |
|---|---|
| PubChem CID | 89012218 |
| Molecular Formula | C21H32S |
| Molecular Weight | 316.55 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 2-butan-2-yl-5-[(2E,4E)-6,6-dimethyl-5-prop-1-en-2-ylocta-2,4-dien-2-yl]thiophene |
| SMILES | C=C(C)/C(=C\C=C(/C)c1ccc(C(C)CC)s1)C(C)(C)CC |
| InChI | InChI=1S/C21H32S/c1-9-16(5)19-13-14-20(22-19)17(6)11-12-18(15(3)4)21(7,8)10-2/h11-14,16H,3,9-10H2,1-2,4-8H3/b17-11+,18-12+ |
| InChIKey | XHGOKGNKUDLTIG-JYFOCSDGSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.55 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|