C19H13F3N4O3S — CID 89012387
[2-[[4-(2,4,6-trifluorobenzoyl)-1H-pyrrole-2-carbonyl]amino]ethanimidoyl] furan-2-carboximidothioate (PubChem CID 89012387) has the molecular formula C19H13F3N4O3S and a molecular weight of 434.40 g/mol. Its IUPAC name is [2-[[4-(2,4,6-trifluorobenzoyl)-1H-pyrrole-2-carbonyl]amino]ethanimidoyl] furan-2-carboximidothioate.
| Compound Name | [2-[[4-(2,4,6-trifluorobenzoyl)-1H-pyrrole-2-carbonyl]amino]ethanimidoyl] furan-2-carboximidothioate |
|---|---|
| PubChem CID | 89012387 |
| Molecular Formula | C19H13F3N4O3S |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | [2-[[4-(2,4,6-trifluorobenzoyl)-1H-pyrrole-2-carbonyl]amino]ethanimidoyl] furan-2-carboximidothioate |
| SMILES | [H]/N=C(/CNC(=O)c1cc(C(=O)c2c(F)cc(F)cc2F)c[nH]1)S/C(=N/[H])c1ccco1 |
| InChI | InChI=1S/C19H13F3N4O3S/c20-10-5-11(21)16(12(22)6-10)17(27)9-4-13(25-7-9)19(28)26-8-15(23)30-18(24)14-2-1-3-29-14/h1-7,23-25H,8H2,(H,26,28)/b23-15-,24-18+ |
| InChIKey | QMVQWDOULFUQAS-NLQIMVTDSA-N |
| XLogP | 3.72 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|