About 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine
1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine (PubChem CID 89012546) has the molecular formula C9H13N3S
and a molecular weight of 195.29 g/mol. Its IUPAC name is 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine |
| PubChem CID | 89012546 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine |
| SMILES | CCC(NC)c1cn2ccsc2n1 |
| InChI | InChI=1S/C9H13N3S/c1-3-7(10-2)8-6-12-4-5-13-9(12)11-8/h4-7,10H,3H2,1-2H3 |
| InChIKey | AYNNASADFMXHFF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine?
The IUPAC name of 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine (CID 89012546) is 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine.
What is the SMILES notation for 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine?
The canonical SMILES for 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine is CCC(NC)c1cn2ccsc2n1.
What is the InChIKey of 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine?
The InChIKey is AYNNASADFMXHFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3S/c1-3-7(10-2)8-6-12-4-5-13-9(12)11-8/h4-7,10H,3H2,1-2H3.
What are the key properties of 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine?
1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine has a molecular weight of 195.29 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imidazo[2,1-b][1,3]thiazol-6-yl-N-methylpropan-1-amine is sourced from PubChem (CID 89012546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).