C24H32O6S — CID 89012597
(1S,2S,4S,5S,7S,13S)-1-methyl-8-(1-methylsulfanylpropoxy)-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one (PubChem CID 89012597) has the molecular formula C24H32O6S and a molecular weight of 448.58 g/mol. Its IUPAC name is (1S,2S,4S,5S,7S,13S)-1-methyl-8-(1-methylsulfanylpropoxy)-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one.
| Compound Name | (1S,2S,4S,5S,7S,13S)-1-methyl-8-(1-methylsulfanylpropoxy)-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
|---|---|
| PubChem CID | 89012597 |
| Molecular Formula | C24H32O6S |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (1S,2S,4S,5S,7S,13S)-1-methyl-8-(1-methylsulfanylpropoxy)-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
| SMILES | CCC(OC1C23OC2C[C@H]2C4=C(CC[C@]2(C)[C@@]32O[C@H]2[C@@H]2O[C@]12C(C)C)C(=O)OC4)SC |
| InChI | InChI=1S/C24H32O6S/c1-6-16(31-5)27-20-22(11(2)3)17(29-22)18-24(30-18)21(4)8-7-12-13(10-26-19(12)25)14(21)9-15-23(20,24)28-15/h11,14-18,20H,6-10H2,1-5H3/t14-,15?,16?,17-,18-,20?,21-,22-,23?,24+/m0/s1 |
| InChIKey | ZXWDPFBNKGCHCL-NUHQOQAYSA-N |
| XLogP | 3.23 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|