About (E)-1,3-dichloroprop-1-ene-1,3-diamine
(E)-1,3-dichloroprop-1-ene-1,3-diamine (PubChem CID 89012781) has the molecular formula C3H6Cl2N2
and a molecular weight of 141.00 g/mol. Its IUPAC name is (E)-1,3-dichloroprop-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | (E)-1,3-dichloroprop-1-ene-1,3-diamine |
| PubChem CID | 89012781 |
| Molecular Formula | C3H6Cl2N2 |
| Molecular Weight | 141.00 g/mol |
| Exact Mass | 139.99 |
| IUPAC Name | (E)-1,3-dichloroprop-1-ene-1,3-diamine |
| SMILES | N/C(Cl)=C\C(N)Cl |
| InChI | InChI=1S/C3H6Cl2N2/c4-2(6)1-3(5)7/h1-2H,6-7H2/b3-1- |
| InChIKey | LANRJCGQWXBYFH-IWQZZHSRSA-N |
| XLogP | 0.55 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.00 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,3-dichloroprop-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,3-dichloroprop-1-ene-1,3-diamine?
The IUPAC name of (E)-1,3-dichloroprop-1-ene-1,3-diamine (CID 89012781) is (E)-1,3-dichloroprop-1-ene-1,3-diamine.
What is the SMILES notation for (E)-1,3-dichloroprop-1-ene-1,3-diamine?
The canonical SMILES for (E)-1,3-dichloroprop-1-ene-1,3-diamine is N/C(Cl)=C\C(N)Cl.
What is the InChIKey of (E)-1,3-dichloroprop-1-ene-1,3-diamine?
The InChIKey is LANRJCGQWXBYFH-IWQZZHSRSA-N. The full InChI is InChI=1S/C3H6Cl2N2/c4-2(6)1-3(5)7/h1-2H,6-7H2/b3-1-.
What are the key properties of (E)-1,3-dichloroprop-1-ene-1,3-diamine?
(E)-1,3-dichloroprop-1-ene-1,3-diamine has a molecular weight of 141.00 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,3-dichloroprop-1-ene-1,3-diamine is sourced from PubChem (CID 89012781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).