C28H37FN2O3 — CID 89012880
(2S,3R)-3-[(2S)-4-benzyl-2-(2-methylpropyl)piperazine-1-carbonyl]-6-(4-fluorophenyl)-2-hydroxyhexanal (PubChem CID 89012880) has the molecular formula C28H37FN2O3 and a molecular weight of 468.61 g/mol. Its IUPAC name is (2S,3R)-3-[(2S)-4-benzyl-2-(2-methylpropyl)piperazine-1-carbonyl]-6-(4-fluorophenyl)-2-hydroxyhexanal.
| Compound Name | (2S,3R)-3-[(2S)-4-benzyl-2-(2-methylpropyl)piperazine-1-carbonyl]-6-(4-fluorophenyl)-2-hydroxyhexanal |
|---|---|
| PubChem CID | 89012880 |
| Molecular Formula | C28H37FN2O3 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | (2S,3R)-3-[(2S)-4-benzyl-2-(2-methylpropyl)piperazine-1-carbonyl]-6-(4-fluorophenyl)-2-hydroxyhexanal |
| SMILES | CC(C)C[C@H]1CN(Cc2ccccc2)CCN1C(=O)[C@H](CCCc1ccc(F)cc1)[C@H](O)C=O |
| InChI | InChI=1S/C28H37FN2O3/c1-21(2)17-25-19-30(18-23-7-4-3-5-8-23)15-16-31(25)28(34)26(27(33)20-32)10-6-9-22-11-13-24(29)14-12-22/h3-5,7-8,11-14,20-21,25-27,33H,6,9-10,15-19H2,1-2H3/t25-,26+,27+/m0/s1 |
| InChIKey | TZTRPVZPDPQJCH-OYUWMTPXSA-N |
| XLogP | 4.08 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|