About 6-ethyl-2,3-dihydro-1,4-benzoxathiine
6-ethyl-2,3-dihydro-1,4-benzoxathiine (PubChem CID 89012903) has the molecular formula C10H12OS
and a molecular weight of 180.27 g/mol. Its IUPAC name is 6-ethyl-2,3-dihydro-1,4-benzoxathiine.
Molecular Properties
| Compound Name | 6-ethyl-2,3-dihydro-1,4-benzoxathiine |
| PubChem CID | 89012903 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 6-ethyl-2,3-dihydro-1,4-benzoxathiine |
| SMILES | CCc1ccc2c(c1)SCCO2 |
| InChI | InChI=1S/C10H12OS/c1-2-8-3-4-9-10(7-8)12-6-5-11-9/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | XCHAVKJLBCYARU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-2,3-dihydro-1,4-benzoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2,3-dihydro-1,4-benzoxathiine?
The IUPAC name of 6-ethyl-2,3-dihydro-1,4-benzoxathiine (CID 89012903) is 6-ethyl-2,3-dihydro-1,4-benzoxathiine.
What is the SMILES notation for 6-ethyl-2,3-dihydro-1,4-benzoxathiine?
The canonical SMILES for 6-ethyl-2,3-dihydro-1,4-benzoxathiine is CCc1ccc2c(c1)SCCO2.
What is the InChIKey of 6-ethyl-2,3-dihydro-1,4-benzoxathiine?
The InChIKey is XCHAVKJLBCYARU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS/c1-2-8-3-4-9-10(7-8)12-6-5-11-9/h3-4,7H,2,5-6H2,1H3.
What are the key properties of 6-ethyl-2,3-dihydro-1,4-benzoxathiine?
6-ethyl-2,3-dihydro-1,4-benzoxathiine has a molecular weight of 180.27 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2,3-dihydro-1,4-benzoxathiine is sourced from PubChem (CID 89012903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).