C18H21N3O3 — CID 8901324
N-[(2R)-butan-2-yl]-N'-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]oxamide (PubChem CID 8901324) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-N'-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]oxamide.
| Compound Name | N-[(2R)-butan-2-yl]-N'-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 8901324 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[(2R)-butan-2-yl]-N'-[(Z)-(2-methoxynaphthalen-1-yl)methylideneamino]oxamide |
| SMILES | CC[C@@H](C)NC(=O)C(=O)N/N=C\c1c(OC)ccc2ccccc12 |
| InChI | InChI=1S/C18H21N3O3/c1-4-12(2)20-17(22)18(23)21-19-11-15-14-8-6-5-7-13(14)9-10-16(15)24-3/h5-12H,4H2,1-3H3,(H,20,22)(H,21,23)/b19-11-/t12-/m1/s1 |
| InChIKey | BOVWQDNOGBUXRK-ZDFPAGSVSA-N |
| XLogP | 2.21 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|