C18H28ClN3 — CID 89013361
3-[(2Z,4E)-4-chlorohepta-2,4,6-trienyl]-5-methyl-1-(3,3,4-trimethylpentyl)-1,2,4-triazole (PubChem CID 89013361) has the molecular formula C18H28ClN3 and a molecular weight of 321.90 g/mol. Its IUPAC name is 3-[(2Z,4E)-4-chlorohepta-2,4,6-trienyl]-5-methyl-1-(3,3,4-trimethylpentyl)-1,2,4-triazole.
| Compound Name | 3-[(2Z,4E)-4-chlorohepta-2,4,6-trienyl]-5-methyl-1-(3,3,4-trimethylpentyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 89013361 |
| Molecular Formula | C18H28ClN3 |
| Molecular Weight | 321.90 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 3-[(2Z,4E)-4-chlorohepta-2,4,6-trienyl]-5-methyl-1-(3,3,4-trimethylpentyl)-1,2,4-triazole |
| SMILES | C=C/C=C(Cl)\C=C/Cc1nc(C)n(CCC(C)(C)C(C)C)n1 |
| InChI | InChI=1S/C18H28ClN3/c1-7-9-16(19)10-8-11-17-20-15(4)22(21-17)13-12-18(5,6)14(2)3/h7-10,14H,1,11-13H2,2-6H3/b10-8-,16-9+ |
| InChIKey | WARWWLABGLEMHO-PWDATKAESA-N |
| XLogP | 5.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.90 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|