C12H18O5 — CID 89013487
1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxypentane-1,3-dione (PubChem CID 89013487) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxypentane-1,3-dione.
| Compound Name | 1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxypentane-1,3-dione |
|---|---|
| PubChem CID | 89013487 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxypentane-1,3-dione |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@H]1C(=O)CC(=O)C(C)O |
| InChI | InChI=1S/C12H18O5/c1-5-10-11(17-12(3,4)16-10)9(15)6-8(14)7(2)13/h5,7,10-11,13H,1,6H2,2-4H3/t7?,10-,11-/m0/s1 |
| InChIKey | YCDBRDZTSHFBFC-KYDCKOQZSA-N |
| XLogP | 0.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|