C20H30O9 — CID 89013818
methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-6-[(2R)-2,3-dihydroxypropyl]-2-methoxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-4-ylidene]acetate (PubChem CID 89013818) has the molecular formula C20H30O9 and a molecular weight of 414.45 g/mol. Its IUPAC name is methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-6-[(2R)-2,3-dihydroxypropyl]-2-methoxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-6-[(2R)-2,3-dihydroxypropyl]-2-methoxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 89013818 |
| Molecular Formula | C20H30O9 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-6-[(2R)-2,3-dihydroxypropyl]-2-methoxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-4-ylidene]acetate |
| SMILES | COC(=O)/C=C1\C[C@@H](C[C@@H](O)CO)O[C@@](OC)(C(C)(C)/C=C/C=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H30O9/c1-13(23)28-18-14(10-17(25)26-4)9-16(11-15(24)12-22)29-20(18,27-5)19(2,3)7-6-8-21/h6-8,10,15-16,18,22,24H,9,11-12H2,1-5H3/b7-6+,14-10+/t15-,16+,18+,20-/m1/s1 |
| InChIKey | PLVKHMDIMJLORI-CVGIEVACSA-N |
| XLogP | 0.67 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|