C19H14ClNO3S — CID 89013900
2-[2-(4-chloro-2-methylphenyl)-5-methyl-1,3-thiazol-4-yl]-4,6-dimethylidenecyclohexane-1,3,5-trione (PubChem CID 89013900) has the molecular formula C19H14ClNO3S and a molecular weight of 371.85 g/mol. Its IUPAC name is 2-[2-(4-chloro-2-methylphenyl)-5-methyl-1,3-thiazol-4-yl]-4,6-dimethylidenecyclohexane-1,3,5-trione.
| Compound Name | 2-[2-(4-chloro-2-methylphenyl)-5-methyl-1,3-thiazol-4-yl]-4,6-dimethylidenecyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 89013900 |
| Molecular Formula | C19H14ClNO3S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 2-[2-(4-chloro-2-methylphenyl)-5-methyl-1,3-thiazol-4-yl]-4,6-dimethylidenecyclohexane-1,3,5-trione |
| SMILES | C=C1C(=O)C(=C)C(=O)C(c2nc(-c3ccc(Cl)cc3C)sc2C)C1=O |
| InChI | InChI=1S/C19H14ClNO3S/c1-8-7-12(20)5-6-13(8)19-21-15(11(4)25-19)14-17(23)9(2)16(22)10(3)18(14)24/h5-7,14H,2-3H2,1,4H3 |
| InChIKey | WDGCHNXRVQCHHJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|