About 4-oxopentan-2-yl 2-methylpropanoate
4-oxopentan-2-yl 2-methylpropanoate (PubChem CID 89014078) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 4-oxopentan-2-yl 2-methylpropanoate.
Molecular Properties
| Compound Name | 4-oxopentan-2-yl 2-methylpropanoate |
| PubChem CID | 89014078 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 4-oxopentan-2-yl 2-methylpropanoate |
| SMILES | CC(=O)CC(C)OC(=O)C(C)C |
| InChI | InChI=1S/C9H16O3/c1-6(2)9(11)12-8(4)5-7(3)10/h6,8H,5H2,1-4H3 |
| InChIKey | YYUVTTKHEZXABH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-oxopentan-2-yl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopentan-2-yl 2-methylpropanoate?
The IUPAC name of 4-oxopentan-2-yl 2-methylpropanoate (CID 89014078) is 4-oxopentan-2-yl 2-methylpropanoate.
What is the SMILES notation for 4-oxopentan-2-yl 2-methylpropanoate?
The canonical SMILES for 4-oxopentan-2-yl 2-methylpropanoate is CC(=O)CC(C)OC(=O)C(C)C.
What is the InChIKey of 4-oxopentan-2-yl 2-methylpropanoate?
The InChIKey is YYUVTTKHEZXABH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-6(2)9(11)12-8(4)5-7(3)10/h6,8H,5H2,1-4H3.
What are the key properties of 4-oxopentan-2-yl 2-methylpropanoate?
4-oxopentan-2-yl 2-methylpropanoate has a molecular weight of 172.22 g/mol, XLogP of 1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopentan-2-yl 2-methylpropanoate is sourced from PubChem (CID 89014078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).