About [(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol
[(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol (PubChem CID 89014166) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is [(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol.
Analyze [(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol?
The IUPAC name of [(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol (CID 89014166) is [(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol.
What is the SMILES notation for [(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol?
The canonical SMILES for [(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol is CCC1=CN[C@H](CO)CC1.
What is the InChIKey of [(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol?
The InChIKey is VFBSXUBFGRUEOD-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H15NO/c1-2-7-3-4-8(6-10)9-5-7/h5,8-10H,2-4,6H2,1H3/t8-/m0/s1.
What are the key properties of [(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol?
[(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol has a molecular weight of 141.21 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-5-ethyl-1,2,3,4-tetrahydropyridin-2-yl]methanol is sourced from PubChem (CID 89014166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).