C20H30N2O3S2 — CID 89014169
2-[2-[(2R)-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carbaldehyde (PubChem CID 89014169) has the molecular formula C20H30N2O3S2 and a molecular weight of 410.61 g/mol. Its IUPAC name is 2-[2-[(2R)-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-[2-[(2R)-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 89014169 |
| Molecular Formula | C20H30N2O3S2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[2-[(2R)-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carbaldehyde |
| SMILES | CCCCC(C)(C)[C@H](O)/C=C/[C@H]1CCC(=O)N1CCSc1nc(C=O)cs1 |
| InChI | InChI=1S/C20H30N2O3S2/c1-4-5-10-20(2,3)17(24)8-6-16-7-9-18(25)22(16)11-12-26-19-21-15(13-23)14-27-19/h6,8,13-14,16-17,24H,4-5,7,9-12H2,1-3H3/b8-6+/t16-,17+/m0/s1 |
| InChIKey | HDANIIJKEDMNJT-AAAWEMBMSA-N |
| XLogP | 4.17 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|