C20H37N — CID 89014705
(4Z,12Z)-3-ethyl-N,2,8,11-tetramethyltetradeca-1,4,12-trien-6-amine (PubChem CID 89014705) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is (4Z,12Z)-3-ethyl-N,2,8,11-tetramethyltetradeca-1,4,12-trien-6-amine.
| Compound Name | (4Z,12Z)-3-ethyl-N,2,8,11-tetramethyltetradeca-1,4,12-trien-6-amine |
|---|---|
| PubChem CID | 89014705 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | (4Z,12Z)-3-ethyl-N,2,8,11-tetramethyltetradeca-1,4,12-trien-6-amine |
| SMILES | C=C(C)C(/C=C\C(CC(C)CCC(C)/C=C\C)NC)CC |
| InChI | InChI=1S/C20H37N/c1-8-10-17(5)11-12-18(6)15-20(21-7)14-13-19(9-2)16(3)4/h8,10,13-14,17-21H,3,9,11-12,15H2,1-2,4-7H3/b10-8-,14-13- |
| InChIKey | XHQKCNQMVOBZCY-URCZFJKLSA-N |
| XLogP | 5.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|