About 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol
3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 89014966) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol.
Molecular Properties
| Compound Name | 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol |
| PubChem CID | 89014966 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | OCCC1COc2cc(O)ccc21 |
| InChI | InChI=1S/C10H12O3/c11-4-3-7-6-13-10-5-8(12)1-2-9(7)10/h1-2,5,7,11-12H,3-4,6H2 |
| InChIKey | KVGUUMAQEVNSLR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol?
The IUPAC name of 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol (CID 89014966) is 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol.
What is the SMILES notation for 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol?
The canonical SMILES for 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol is OCCC1COc2cc(O)ccc21.
What is the InChIKey of 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol?
The InChIKey is KVGUUMAQEVNSLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c11-4-3-7-6-13-10-5-8(12)1-2-9(7)10/h1-2,5,7,11-12H,3-4,6H2.
What are the key properties of 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol?
3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol has a molecular weight of 180.20 g/mol, XLogP of 1.25, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyethyl)-2,3-dihydro-1-benzofuran-6-ol is sourced from PubChem (CID 89014966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).