C21H21FN6O — CID 89015115
N'-[N-ethenyl-4-[[4-(3-fluoro-4-methoxyphenyl)pyrimidin-2-yl]amino]anilino]ethanimidamide (PubChem CID 89015115) has the molecular formula C21H21FN6O and a molecular weight of 392.44 g/mol. Its IUPAC name is N'-[N-ethenyl-4-[[4-(3-fluoro-4-methoxyphenyl)pyrimidin-2-yl]amino]anilino]ethanimidamide.
| Compound Name | N'-[N-ethenyl-4-[[4-(3-fluoro-4-methoxyphenyl)pyrimidin-2-yl]amino]anilino]ethanimidamide |
|---|---|
| PubChem CID | 89015115 |
| Molecular Formula | C21H21FN6O |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N'-[N-ethenyl-4-[[4-(3-fluoro-4-methoxyphenyl)pyrimidin-2-yl]amino]anilino]ethanimidamide |
| SMILES | C=CN(/N=C(/C)N)c1ccc(Nc2nccc(-c3ccc(OC)c(F)c3)n2)cc1 |
| InChI | InChI=1S/C21H21FN6O/c1-4-28(27-14(2)23)17-8-6-16(7-9-17)25-21-24-12-11-19(26-21)15-5-10-20(29-3)18(22)13-15/h4-13H,1H2,2-3H3,(H2,23,27)(H,24,25,26) |
| InChIKey | JDYZOOBSGSGSPJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|