C30H29N9O — CID 89015275
N'-[4-[[4-[3-cyano-5-(3-hydroxypiperidin-1-yl)phenyl]pyrimidin-2-yl]amino]-N-ethenylanilino]pyridine-4-carboximidamide (PubChem CID 89015275) has the molecular formula C30H29N9O and a molecular weight of 531.62 g/mol. Its IUPAC name is N'-[4-[[4-[3-cyano-5-(3-hydroxypiperidin-1-yl)phenyl]pyrimidin-2-yl]amino]-N-ethenylanilino]pyridine-4-carboximidamide.
| Compound Name | N'-[4-[[4-[3-cyano-5-(3-hydroxypiperidin-1-yl)phenyl]pyrimidin-2-yl]amino]-N-ethenylanilino]pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 89015275 |
| Molecular Formula | C30H29N9O |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | N'-[4-[[4-[3-cyano-5-(3-hydroxypiperidin-1-yl)phenyl]pyrimidin-2-yl]amino]-N-ethenylanilino]pyridine-4-carboximidamide |
| SMILES | C=CN(/N=C(\N)c1ccncc1)c1ccc(Nc2nccc(-c3cc(C#N)cc(N4CCCC(O)C4)c3)n2)cc1 |
| InChI | InChI=1S/C30H29N9O/c1-2-39(37-29(32)22-9-12-33-13-10-22)25-7-5-24(6-8-25)35-30-34-14-11-28(36-30)23-16-21(19-31)17-26(18-23)38-15-3-4-27(40)20-38/h2,5-14,16-18,27,40H,1,3-4,15,20H2,(H2,32,37)(H,34,35,36) |
| InChIKey | CQRSPJWSKRIMNJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 139.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|