About (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine
(Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine (PubChem CID 8901557) has the molecular formula C17H21ClN4O
and a molecular weight of 332.84 g/mol. Its IUPAC name is (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine.
Molecular Properties
| Compound Name | (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine |
| PubChem CID | 8901557 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine |
| SMILES | Cc1ccc(C)c(-n2nc(C)c(C=NN3CCOCC3)c2Cl)c1 |
| InChI | InChI=1S/C17H21ClN4O/c1-12-4-5-13(2)16(10-12)22-17(18)15(14(3)20-22)11-19-21-6-8-23-9-7-21/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | PFSPKTRHNWGFHG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine?
The IUPAC name of (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine (CID 8901557) is (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine.
What is the SMILES notation for (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine?
The canonical SMILES for (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine is Cc1ccc(C)c(-n2nc(C)c(C=NN3CCOCC3)c2Cl)c1.
What is the InChIKey of (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine?
The InChIKey is PFSPKTRHNWGFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN4O/c1-12-4-5-13(2)16(10-12)22-17(18)15(14(3)20-22)11-19-21-6-8-23-9-7-21/h4-5,10-11H,6-9H2,1-3H3.
What are the key properties of (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine?
(Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine has a molecular weight of 332.84 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[5-chloro-1-(2,5-dimethylphenyl)-3-methylpyrazol-4-yl]-N-morpholin-4-ylmethanimine is sourced from PubChem (CID 8901557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).