About (2-bromo-3,4,5-trifluorophenyl)methanol
(2-bromo-3,4,5-trifluorophenyl)methanol (PubChem CID 89016097) has the molecular formula C7H4BrF3O
and a molecular weight of 241.01 g/mol. Its IUPAC name is (2-bromo-3,4,5-trifluorophenyl)methanol.
Molecular Properties
| Compound Name | (2-bromo-3,4,5-trifluorophenyl)methanol |
| PubChem CID | 89016097 |
| Molecular Formula | C7H4BrF3O |
| Molecular Weight | 241.01 g/mol |
| Exact Mass | 239.94 |
| IUPAC Name | (2-bromo-3,4,5-trifluorophenyl)methanol |
| SMILES | OCc1cc(F)c(F)c(F)c1Br |
| InChI | InChI=1S/C7H4BrF3O/c8-5-3(2-12)1-4(9)6(10)7(5)11/h1,12H,2H2 |
| InChIKey | HOFDURQEASOZBV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.01 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-3,4,5-trifluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-3,4,5-trifluorophenyl)methanol?
The IUPAC name of (2-bromo-3,4,5-trifluorophenyl)methanol (CID 89016097) is (2-bromo-3,4,5-trifluorophenyl)methanol.
What is the SMILES notation for (2-bromo-3,4,5-trifluorophenyl)methanol?
The canonical SMILES for (2-bromo-3,4,5-trifluorophenyl)methanol is OCc1cc(F)c(F)c(F)c1Br.
What is the InChIKey of (2-bromo-3,4,5-trifluorophenyl)methanol?
The InChIKey is HOFDURQEASOZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrF3O/c8-5-3(2-12)1-4(9)6(10)7(5)11/h1,12H,2H2.
What are the key properties of (2-bromo-3,4,5-trifluorophenyl)methanol?
(2-bromo-3,4,5-trifluorophenyl)methanol has a molecular weight of 241.01 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-3,4,5-trifluorophenyl)methanol is sourced from PubChem (CID 89016097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).