C21H25F3N4O2S — CID 89016177
4-[4-ethoxy-7-[2-(2,2,2-trifluoroethylamino)ethoxy]quinolin-2-yl]-N-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 89016177) has the molecular formula C21H25F3N4O2S and a molecular weight of 454.52 g/mol. Its IUPAC name is 4-[4-ethoxy-7-[2-(2,2,2-trifluoroethylamino)ethoxy]quinolin-2-yl]-N-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | 4-[4-ethoxy-7-[2-(2,2,2-trifluoroethylamino)ethoxy]quinolin-2-yl]-N-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 89016177 |
| Molecular Formula | C21H25F3N4O2S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 4-[4-ethoxy-7-[2-(2,2,2-trifluoroethylamino)ethoxy]quinolin-2-yl]-N-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | CCOc1cc(-c2csc(NC(C)C)n2)nc2cc(OCCNCC(F)(F)F)ccc12 |
| InChI | InChI=1S/C21H25F3N4O2S/c1-4-29-19-10-17(18-11-31-20(28-18)26-13(2)3)27-16-9-14(5-6-15(16)19)30-8-7-25-12-21(22,23)24/h5-6,9-11,13,25H,4,7-8,12H2,1-3H3,(H,26,28) |
| InChIKey | OCPKEIMNHQVPMQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|