C11H13F3O3 — CID 89016387
(2R)-2-[(3Z,5E)-5-(trifluoromethyl)hepta-1,3,5-trien-2-yl]oxypropanoic acid (PubChem CID 89016387) has the molecular formula C11H13F3O3 and a molecular weight of 250.22 g/mol. Its IUPAC name is (2R)-2-[(3Z,5E)-5-(trifluoromethyl)hepta-1,3,5-trien-2-yl]oxypropanoic acid.
| Compound Name | (2R)-2-[(3Z,5E)-5-(trifluoromethyl)hepta-1,3,5-trien-2-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 89016387 |
| Molecular Formula | C11H13F3O3 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (2R)-2-[(3Z,5E)-5-(trifluoromethyl)hepta-1,3,5-trien-2-yl]oxypropanoic acid |
| SMILES | C=C(/C=C\C(=C/C)C(F)(F)F)O[C@H](C)C(=O)O |
| InChI | InChI=1S/C11H13F3O3/c1-4-9(11(12,13)14)6-5-7(2)17-8(3)10(15)16/h4-6,8H,2H2,1,3H3,(H,15,16)/b6-5-,9-4+/t8-/m1/s1 |
| InChIKey | SSPIQAVYXWGENE-BHRCAFGWSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|