C10H11NO2 — CID 89016434
(4E,6Z,8E)-4,9-dimethyl-1H-azonine-2,3-dione (PubChem CID 89016434) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (4E,6Z,8E)-4,9-dimethyl-1H-azonine-2,3-dione.
| Compound Name | (4E,6Z,8E)-4,9-dimethyl-1H-azonine-2,3-dione |
|---|---|
| PubChem CID | 89016434 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (4E,6Z,8E)-4,9-dimethyl-1H-azonine-2,3-dione |
| SMILES | C/C1=C\C=C/C=C(\C)C(=O)C(=O)N1 |
| InChI | InChI=1S/C10H11NO2/c1-7-5-3-4-6-8(2)11-10(13)9(7)12/h3-6H,1-2H3,(H,11,13)/b4-3-,7-5+,8-6+ |
| InChIKey | JMVUWTNXZPCFPO-MBAZBMQQSA-N |
| XLogP | 1.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|