About 5-fluoro-3,6-dimethyl-1,2-dihydropyridine
5-fluoro-3,6-dimethyl-1,2-dihydropyridine (PubChem CID 89016448) has the molecular formula C7H10FN
and a molecular weight of 127.16 g/mol. Its IUPAC name is 5-fluoro-3,6-dimethyl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 5-fluoro-3,6-dimethyl-1,2-dihydropyridine |
| PubChem CID | 89016448 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 5-fluoro-3,6-dimethyl-1,2-dihydropyridine |
| SMILES | CC1=CC(F)=C(C)NC1 |
| InChI | InChI=1S/C7H10FN/c1-5-3-7(8)6(2)9-4-5/h3,9H,4H2,1-2H3 |
| InChIKey | QPUFCHBRODFDHX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-3,6-dimethyl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3,6-dimethyl-1,2-dihydropyridine?
The IUPAC name of 5-fluoro-3,6-dimethyl-1,2-dihydropyridine (CID 89016448) is 5-fluoro-3,6-dimethyl-1,2-dihydropyridine.
What is the SMILES notation for 5-fluoro-3,6-dimethyl-1,2-dihydropyridine?
The canonical SMILES for 5-fluoro-3,6-dimethyl-1,2-dihydropyridine is CC1=CC(F)=C(C)NC1.
What is the InChIKey of 5-fluoro-3,6-dimethyl-1,2-dihydropyridine?
The InChIKey is QPUFCHBRODFDHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FN/c1-5-3-7(8)6(2)9-4-5/h3,9H,4H2,1-2H3.
What are the key properties of 5-fluoro-3,6-dimethyl-1,2-dihydropyridine?
5-fluoro-3,6-dimethyl-1,2-dihydropyridine has a molecular weight of 127.16 g/mol, XLogP of 1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3,6-dimethyl-1,2-dihydropyridine is sourced from PubChem (CID 89016448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).