C21H24ClIN2O2 — CID 89016539
6-(3-chloro-4-methylphenyl)-6-(5-cyclopropyl-6-oxo-1H-pyridin-2-yl)-4-iodohexanamide (PubChem CID 89016539) has the molecular formula C21H24ClIN2O2 and a molecular weight of 498.79 g/mol. Its IUPAC name is 6-(3-chloro-4-methylphenyl)-6-(5-cyclopropyl-6-oxo-1H-pyridin-2-yl)-4-iodohexanamide.
| Compound Name | 6-(3-chloro-4-methylphenyl)-6-(5-cyclopropyl-6-oxo-1H-pyridin-2-yl)-4-iodohexanamide |
|---|---|
| PubChem CID | 89016539 |
| Molecular Formula | C21H24ClIN2O2 |
| Molecular Weight | 498.79 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | 6-(3-chloro-4-methylphenyl)-6-(5-cyclopropyl-6-oxo-1H-pyridin-2-yl)-4-iodohexanamide |
| SMILES | Cc1ccc(C(CC(I)CCC(N)=O)c2ccc(C3CC3)c(=O)[nH]2)cc1Cl |
| InChI | InChI=1S/C21H24ClIN2O2/c1-12-2-3-14(10-18(12)22)17(11-15(23)6-9-20(24)26)19-8-7-16(13-4-5-13)21(27)25-19/h2-3,7-8,10,13,15,17H,4-6,9,11H2,1H3,(H2,24,26)(H,25,27) |
| InChIKey | VYNNUPSCSGFDMM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.79 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|