C14H21FN2 — CID 89016765
(E)-3-fluoro-6,6-dimethyl-2,5-dimethylidene-N'-[(Z)-prop-1-enyl]hept-3-enimidamide (PubChem CID 89016765) has the molecular formula C14H21FN2 and a molecular weight of 236.33 g/mol. Its IUPAC name is (E)-3-fluoro-6,6-dimethyl-2,5-dimethylidene-N'-[(Z)-prop-1-enyl]hept-3-enimidamide.
| Compound Name | (E)-3-fluoro-6,6-dimethyl-2,5-dimethylidene-N'-[(Z)-prop-1-enyl]hept-3-enimidamide |
|---|---|
| PubChem CID | 89016765 |
| Molecular Formula | C14H21FN2 |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | (E)-3-fluoro-6,6-dimethyl-2,5-dimethylidene-N'-[(Z)-prop-1-enyl]hept-3-enimidamide |
| SMILES | C=C(/C(N)=N/C=C\C)/C(F)=C\C(=C)C(C)(C)C |
| InChI | InChI=1S/C14H21FN2/c1-7-8-17-13(16)11(3)12(15)9-10(2)14(4,5)6/h7-9H,2-3H2,1,4-6H3,(H2,16,17)/b8-7-,12-9+ |
| InChIKey | WQRJDOPHEIRTMT-HVTAIUIQSA-N |
| XLogP | 3.89 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|