C19H17Cl3N4OS — CID 89016986
4-[(1-chloropiperidin-3-yl)methyl]-2-(3,5-dichlorophenyl)thieno[2,3-d]pyridazine-7-carboxamide (PubChem CID 89016986) has the molecular formula C19H17Cl3N4OS and a molecular weight of 455.80 g/mol. Its IUPAC name is 4-[(1-chloropiperidin-3-yl)methyl]-2-(3,5-dichlorophenyl)thieno[2,3-d]pyridazine-7-carboxamide.
| Compound Name | 4-[(1-chloropiperidin-3-yl)methyl]-2-(3,5-dichlorophenyl)thieno[2,3-d]pyridazine-7-carboxamide |
|---|---|
| PubChem CID | 89016986 |
| Molecular Formula | C19H17Cl3N4OS |
| Molecular Weight | 455.80 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | 4-[(1-chloropiperidin-3-yl)methyl]-2-(3,5-dichlorophenyl)thieno[2,3-d]pyridazine-7-carboxamide |
| SMILES | NC(=O)c1nnc(CC2CCCN(Cl)C2)c2cc(-c3cc(Cl)cc(Cl)c3)sc12 |
| InChI | InChI=1S/C19H17Cl3N4OS/c20-12-5-11(6-13(21)7-12)16-8-14-15(4-10-2-1-3-26(22)9-10)24-25-17(19(23)27)18(14)28-16/h5-8,10H,1-4,9H2,(H2,23,27) |
| InChIKey | YEPIKUGNNGAAQB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.80 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|