C41H48N2 — CID 89017120
2-N,7-N-di(cyclohexa-2,4-dien-1-yl)-9,9-dimethyl-2-N,7-N-bis(5-methylcyclohexa-1,5-dien-1-yl)-1,5,6,9a-tetrahydrofluorene-2,7-diamine (PubChem CID 89017120) has the molecular formula C41H48N2 and a molecular weight of 568.85 g/mol. Its IUPAC name is 2-N,7-N-di(cyclohexa-2,4-dien-1-yl)-9,9-dimethyl-2-N,7-N-bis(5-methylcyclohexa-1,5-dien-1-yl)-1,5,6,9a-tetrahydrofluorene-2,7-diamine.
| Compound Name | 2-N,7-N-di(cyclohexa-2,4-dien-1-yl)-9,9-dimethyl-2-N,7-N-bis(5-methylcyclohexa-1,5-dien-1-yl)-1,5,6,9a-tetrahydrofluorene-2,7-diamine |
|---|---|
| PubChem CID | 89017120 |
| Molecular Formula | C41H48N2 |
| Molecular Weight | 568.85 g/mol |
| Exact Mass | 568.38 |
| IUPAC Name | 2-N,7-N-di(cyclohexa-2,4-dien-1-yl)-9,9-dimethyl-2-N,7-N-bis(5-methylcyclohexa-1,5-dien-1-yl)-1,5,6,9a-tetrahydrofluorene-2,7-diamine |
| SMILES | CC1=CC(N(C2=CC3=C(CC2)C2=CC=C(N(C4=CCCC(C)=C4)C4C=CC=CC4)CC2C3(C)C)C2C=CC=CC2)=CCC1 |
| InChI | InChI=1S/C41H48N2/c1-29-13-11-19-33(25-29)42(31-15-7-5-8-16-31)35-21-23-37-38-24-22-36(28-40(38)41(3,4)39(37)27-35)43(32-17-9-6-10-18-32)34-20-12-14-30(2)26-34/h5-10,15,17,19-21,23,25-26,28,31-32,39H,11-14,16,18,22,24,27H2,1-4H3 |
| InChIKey | CZYVAJCQRMRYLL-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.85 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |